Giáo án Hình học lớp 10 - Nguyễn Hồng Tú: Công thức lượng giác

I. Mục tiêu dạy học

Sau khi học xong tiết này, học sinh có khả năng:

* Về kiến thức

- Hiểu công thức tính sin, côsin, tang của tổng, hiệu hai góc.

* Về kỹ năng

- Vận dụng được công thức tính sin, côsin, tang của tổng, hiệu hai góc để giải các bài toán như tính giá trị lượng giác của một góc, rút gọn những biểu thức lượng giác đơn giản và chứng minh một số đẳng thức.

* Về thái độ

- Rèn luyện tính tỉ mỉ, tư duy linh hoạt.

II. Phương tiện dạy học

* Giáo viên: giáo án, sách giáo khoa.

* Học sinh: sách giáo khoa, vở ghi, máy tính bỏ túi, phấn, bảng.

III. Phương pháp dạy học

- Vấn đáp, thuyết trình, nêu vấn đề.

IV. Tiến trình dạy học

1. Ổn định lớp, kiểm diện.

2. Kiểm tra bài cũ:

 

docx5 trang | Chia sẻ: liennguyen452 | Ngày: 09/11/2015 | Lượt xem: 563 | Lượt tải: 0download
Bạn đang xem nội dung tài liệu Giáo án Hình học lớp 10 - Nguyễn Hồng Tú: Công thức lượng giác, để tải tài liệu về máy bạn click vào nút DOWNLOAD ở trên
GIÁO ÁN GIẢNG DẠY Trường: THPT Nguyễn Hữu Huân. Người dạy: Nguyễn Hồng Tú. Bài dạy: Công thức lượng giác (môn Hình học 10 – chương trình cơ bản). Số tiết: 3 Tiết thứ: 1 Lớp dạy: 10A5 Ngày dạy: 25/03/2013 Đối tượng: I. Mục tiêu dạy học Sau khi học xong tiết này, học sinh có khả năng: * Về kiến thức - Hiểu công thức tính sin, côsin, tang của tổng, hiệu hai góc. * Về kỹ năng - Vận dụng được công thức tính sin, côsin, tang của tổng, hiệu hai góc để giải các bài toán như tính giá trị lượng giác của một góc, rút gọn những biểu thức lượng giác đơn giản và chứng minh một số đẳng thức. * Về thái độ - Rèn luyện tính tỉ mỉ, tư duy linh hoạt. II. Phương tiện dạy học * Giáo viên: giáo án, sách giáo khoa. * Học sinh: sách giáo khoa, vở ghi, máy tính bỏ túi, phấn, bảng. III. Phương pháp dạy học - Vấn đáp, thuyết trình, nêu vấn đề. IV. Tiến trình dạy học 1. Ổn định lớp, kiểm diện. 2. Kiểm tra bài cũ: Hoạt động của giáo viên Hoạt động của học sinh - Gọi 2 học sinh lên bảng kiểm tra bài cũ: Học sinh 1: Xác định dấu của các giá trị lượng giác: a) sin(π2-α) với π2<α<π. b) tan(π+α) với 0<α<π. Học sinh 2: Tính giá trị của biểu thức sin45o.cos30o+cos45o.sin30o - Học sinh 1: a) sin(π2-α) = cosα <0 với π2<α<π. b) tan(π+α) = tanα = sinαcosα . Mà sinα>0; cosα>0 với 00. - Học sinh 2: sin45o.cos30o+cos45o.sin30o= 22.32+22.12=6+24. 3. Bài mới: Hoạt động của giáo viên Hoạt động của học sinh Lưu bảng Hoạt động 1: Giới thiệu bài mới - Giáo viên yêu cầu học sinh 2 trên dùng máy tính bỏ túi để tính sin75o và so sánh với giá trị của biểu thức vừa tính. - Giáo viên: Thay vì ghi 75o, ta có thể ghi lại là (45o+30o) (giáo viên ghi lại đẳng thức). - Giáo viên đặt vấn đề: nếu thay 45o = a, 30o = b thì ta ghi lại đẳng thức trên như thế nào? - Giáo viên khẳng định: thật ra công thức (*) không chỉ đúng với a=45o, b=30o mà còn luôn đúng với a, b là các góc lượng giác bất kỳ. Đây là một trong những công thức được gọi là công thức cộng mà ta sẽ học hôm nay. - Học sinh dùng máy tính bỏ túi để tính sin75o và kết luận hai giá trị trên bằng nhau. - Học sinh 2 viết lại: sina.cosb+cosa.sinb = sin(a+b) (*). - Giáo viên và học sinh trình bày ở bảng phụ. Hoạt động 2: công thức cộng - Giáo viên trình bày bảng các công thức cộng: sin(a+b)=sina.cosb+cos.sinb sin(a–b)=sina.cosb–cosa.sinb cos(a+b)=cosa.cosb–sina.sinb cos(a–b)=cosa.cosb+sina.sinb tan(a+b)=tana+tanb1-tana.tanb tan(a-b)= tana-tanb1+tana.tanb - Giáo viên: “Trong chương trình cơ bản, chúng ta thừa nhận các công thức trên đây mà không chứng minh. Ai quan tâm đến chứng minh có thể tham khảo trong sách giáo khoa nâng cao”. - Giáo viên hướng dẫn học sinh cách nhớ các công thức trên. - Giáo viên: “Theo các công thức trên, nếu a và b là các góc lượng giác đặc biệt, ta có thể tính giá trị lượng giác của các góc khác không đặc biệt như a+b, a-b”. - Giáo viên đưa ra ví dụ 1: Ví dụ 1. Tính: a) cos15o; b) tan7π12. - Giáo viên hướng dẫn học sinh và gọi lần lượt hai học sinh lên bảng giải quyết. - Giáo viên lưu ý học sinh một số sai lầm mắc phải như: sin(a+b) = sina+sinb, cosa-cosb=cos(a-b). - Giáo viên quay lại phần trả bài của học sinh 1 và nhắc nhở: “Trong trường hợp các em quên các công thức giá trị lượng giác của các cung liên kết, các em có thể sử dụng công thức cộng để tìm lại được các công thức đó, chẳng hạn sin(π2-α) = sinπ2.cosα - cosπ2.sinα = cosα”. - Giáo viên đưa ra ví dụ 2 và yêu cầu học sinh lên bảng giải quyết: Ví dụ 2: Rút gọn các biểu thức: a) sin75o.cos15o+cos75o.sin15o. b) tan110o+cot80o1-tan110o.cot80o. - Giáo viên: “Ngoài 2 dạng bài tập ở ví dụ 1 và 2, công thức cộng còn áp dụng cho một dạng bài tập khác là dạng chứng minh đẳng thức”. - Giáo viên đưa ra ví dụ 3 và yêu cầu học sinh lên bảng giải quyết: Ví dụ 3: Chứng minh: a) sina-b+2cosa.sinb-2sina.sinb+cos(a-b)=tan(a+b). b) Cho A, B, C là 3 góc trong 1 tam giác. Chứng minh: sinA.sinB-cosC=cosA.cosB. - Học sinh ghi nhận. - Hai học sinh lần lượt lên bảng giải quyết, các học sinh còn lại thực hiện ví dụ vào vở rồi đối chiếu với bài làm trên bảng. - Hai học sinh lần lượt lên bảng giải quyết dưới sự hướng dẫn của giáo viên. Các học sinh còn lại theo dõi, ghi nhận. - Hai học sinh lần lượt lên bảng giải quyết dưới sự hướng dẫn của giáo viên. Các học sinh còn lại theo dõi, ghi nhận. I. Công thức cộng sin(a+b)=sina.cosb+cosa.sinb sin(a–b)=sina.cosb–cosa.sinb cos(a+b)=cosa.cosb–sina.sinb cos(a–b)=cosa.cosb+sina.sinb tan(a+b)=tana+tanb1-tana.tanb tan(a-b)= tana-tanb1+tana.tanb Ví dụ 1: Tính cos15o; tan7π12. a) cos15o=cos(45o – 30o) = cos45o.cos30o+sin45o.sin30o = 22.32+22.12=6+24. b) tan7π12 = tan(π3+π4) = tanπ3+tanπ41-tanπ3.tanπ4 = 3+11-3. Ví dụ 2: Rút gọn các biểu thức: a) sin75o.cos15o+cos75o.sin15o = sin(75o+15o)=sin90o=1. b) tan110o+cot80o1-tan110o.cot80o=tan110o+tan10o1-tan110o.tan10o=tan110o+10o=tan120o=-3. Ví dụ 3: Chứng minh: a) VP=sina-b+2cosa.sinb-2sina.sinb+cos(a-b)=sina.cosb-cosa.sinb+2cosa.sinb-2sina.sinb+cosa.cosb+sina.sinb=sina.cosb+cosa.sinbcosa.cosb-sina.sinb=sin(a+b)cos(a+b)=tan(a+b)=VT(dpcm). b) VT=sinA.sinB-cosC=sinA.sinB-cosπ-A+B=sinA.sinB+cosA+B=sinA.sinB+cosA.cosB-sinA.sinB=cosA.cosB=VP(dpcm). 4. Củng cố - Giáo viên cho học sinh nhắc lại các công thức cộng vừa được học và hướng dẫn lại cách nhớ. - Các công thức cộng có thể áp dụng cho 3 dạng bài tập: tính giá trị lượng giác của một góc, rút gọn biểu thức, chứng minh đẳng thức. 5. Bài tập về nhà - Giáo viên yêu cầu học sinh thực hiện ở nhà các bài tập 1, 2, 3 trong sách giáo khoa.

File đính kèm:

  • docxgiao an tiet cong thuc cong.docx
Giáo án liên quan